C21H28N6O3S — CID 87882841
[5-[tert-butylcarbamoyl(sulfanyl)amino]-2-pyridinyl] 4-(pyridin-3-ylmethyl)piperazine-1-carboxylate (PubChem CID 87882841) has the molecular formula C21H28N6O3S and a molecular weight of 444.56 g/mol. Its IUPAC name is [5-[tert-butylcarbamoyl(sulfanyl)amino]-2-pyridinyl] 4-(pyridin-3-ylmethyl)piperazine-1-carboxylate.
| Compound Name | [5-[tert-butylcarbamoyl(sulfanyl)amino]-2-pyridinyl] 4-(pyridin-3-ylmethyl)piperazine-1-carboxylate |
|---|---|
| PubChem CID | 87882841 |
| Molecular Formula | C21H28N6O3S |
| Molecular Weight | 444.56 g/mol |
| Exact Mass | 444.19 |
| IUPAC Name | [5-[tert-butylcarbamoyl(sulfanyl)amino]-2-pyridinyl] 4-(pyridin-3-ylmethyl)piperazine-1-carboxylate |
| SMILES | CC(C)(C)NC(=O)N(S)c1ccc(OC(=O)N2CCN(Cc3cccnc3)CC2)nc1 |
| InChI | InChI=1S/C21H28N6O3S/c1-21(2,3)24-19(28)27(31)17-6-7-18(23-14-17)30-20(29)26-11-9-25(10-12-26)15-16-5-4-8-22-13-16/h4-8,13-14,31H,9-12,15H2,1-3H3,(H,24,28) |
| InChIKey | KRZXTJGFKIZMKQ-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 90.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.56 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|