C21H23Cl2NO5S — CID 87886255
2-[(2,4-dichloro-5-piperidin-1-ylsulfonylphenyl)methoxy]-2-(3-methoxyphenyl)acetaldehyde (PubChem CID 87886255) has the molecular formula C21H23Cl2NO5S and a molecular weight of 472.39 g/mol. Its IUPAC name is 2-[(2,4-dichloro-5-piperidin-1-ylsulfonylphenyl)methoxy]-2-(3-methoxyphenyl)acetaldehyde.
| Compound Name | 2-[(2,4-dichloro-5-piperidin-1-ylsulfonylphenyl)methoxy]-2-(3-methoxyphenyl)acetaldehyde |
|---|---|
| PubChem CID | 87886255 |
| Molecular Formula | C21H23Cl2NO5S |
| Molecular Weight | 472.39 g/mol |
| Exact Mass | 471.07 |
| IUPAC Name | 2-[(2,4-dichloro-5-piperidin-1-ylsulfonylphenyl)methoxy]-2-(3-methoxyphenyl)acetaldehyde |
| SMILES | COc1cccc(C(C=O)OCc2cc(S(=O)(=O)N3CCCCC3)c(Cl)cc2Cl)c1 |
| InChI | InChI=1S/C21H23Cl2NO5S/c1-28-17-7-5-6-15(10-17)20(13-25)29-14-16-11-21(19(23)12-18(16)22)30(26,27)24-8-3-2-4-9-24/h5-7,10-13,20H,2-4,8-9,14H2,1H3 |
| InChIKey | WBTMJBISARSSQV-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.39 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|