C13H15ClFN3O2 — CID 87887068
N-(1-acetylpiperidin-4-yl)-2-chloro-6-fluoropyridine-3-carboxamide (PubChem CID 87887068) has the molecular formula C13H15ClFN3O2 and a molecular weight of 299.73 g/mol. Its IUPAC name is N-(1-acetylpiperidin-4-yl)-2-chloro-6-fluoropyridine-3-carboxamide.
| Compound Name | N-(1-acetylpiperidin-4-yl)-2-chloro-6-fluoropyridine-3-carboxamide |
|---|---|
| PubChem CID | 87887068 |
| Molecular Formula | C13H15ClFN3O2 |
| Molecular Weight | 299.73 g/mol |
| Exact Mass | 299.08 |
| IUPAC Name | N-(1-acetylpiperidin-4-yl)-2-chloro-6-fluoropyridine-3-carboxamide |
| SMILES | CC(=O)N1CCC(NC(=O)c2ccc(F)nc2Cl)CC1 |
| InChI | InChI=1S/C13H15ClFN3O2/c1-8(19)18-6-4-9(5-7-18)16-13(20)10-2-3-11(15)17-12(10)14/h2-3,9H,4-7H2,1H3,(H,16,20) |
| InChIKey | ADRVAZHZWGSJSC-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.73 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|