C24H30N2O4S — CID 87888300
[3-[6-methyl-3-(3-phenylpropyl)-3-azabicyclo[3.1.0]hexan-6-yl]-N-methylsulfonylanilino] acetate (PubChem CID 87888300) has the molecular formula C24H30N2O4S and a molecular weight of 442.58 g/mol. Its IUPAC name is [3-[6-methyl-3-(3-phenylpropyl)-3-azabicyclo[3.1.0]hexan-6-yl]-N-methylsulfonylanilino] acetate.
| Compound Name | [3-[6-methyl-3-(3-phenylpropyl)-3-azabicyclo[3.1.0]hexan-6-yl]-N-methylsulfonylanilino] acetate |
|---|---|
| PubChem CID | 87888300 |
| Molecular Formula | C24H30N2O4S |
| Molecular Weight | 442.58 g/mol |
| Exact Mass | 442.19 |
| IUPAC Name | [3-[6-methyl-3-(3-phenylpropyl)-3-azabicyclo[3.1.0]hexan-6-yl]-N-methylsulfonylanilino] acetate |
| SMILES | CC(=O)ON(c1cccc(C2(C)C3CN(CCCc4ccccc4)CC32)c1)S(C)(=O)=O |
| InChI | InChI=1S/C24H30N2O4S/c1-18(27)30-26(31(3,28)29)21-13-7-12-20(15-21)24(2)22-16-25(17-23(22)24)14-8-11-19-9-5-4-6-10-19/h4-7,9-10,12-13,15,22-23H,8,11,14,16-17H2,1-3H3 |
| InChIKey | ZVHKIYDVBZHOOF-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.58 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|