C16H12F7NO3 — CID 87890162
2-[7-fluoro-5-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2,3-dihydro-1H-pyrrolo[1,2-a]indol-3-yl]acetic acid (PubChem CID 87890162) has the molecular formula C16H12F7NO3 and a molecular weight of 399.26 g/mol. Its IUPAC name is 2-[7-fluoro-5-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2,3-dihydro-1H-pyrrolo[1,2-a]indol-3-yl]acetic acid.
| Compound Name | 2-[7-fluoro-5-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2,3-dihydro-1H-pyrrolo[1,2-a]indol-3-yl]acetic acid |
|---|---|
| PubChem CID | 87890162 |
| Molecular Formula | C16H12F7NO3 |
| Molecular Weight | 399.26 g/mol |
| Exact Mass | 399.07 |
| IUPAC Name | 2-[7-fluoro-5-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2,3-dihydro-1H-pyrrolo[1,2-a]indol-3-yl]acetic acid |
| SMILES | O=C(O)CC1CCn2c1cc1c(C(O)(C(F)(F)F)C(F)(F)F)cc(F)cc12 |
| InChI | InChI=1S/C16H12F7NO3/c17-8-4-10(14(27,15(18,19)20)16(21,22)23)9-6-11-7(3-13(25)26)1-2-24(11)12(9)5-8/h4-7,27H,1-3H2,(H,25,26) |
| InChIKey | CDSRGOZZWGGZAD-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 62.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.26 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |