C23H17F3N4O4 — CID 143838254
2-[6-[5-[5-cyano-3-(trifluoromethoxy)cyclohexa-1,5-dien-1-yl]-1,2,4-oxadiazol-3-yl]-2,3-dihydro-1H-pyrrolo[1,2-a]indol-3-yl]acetic acid (PubChem CID 143838254) has the molecular formula C23H17F3N4O4 and a molecular weight of 470.41 g/mol. Its IUPAC name is 2-[6-[5-[5-cyano-3-(trifluoromethoxy)cyclohexa-1,5-dien-1-yl]-1,2,4-oxadiazol-3-yl]-2,3-dihydro-1H-pyrrolo[1,2-a]indol-3-yl]acetic acid.
| Compound Name | 2-[6-[5-[5-cyano-3-(trifluoromethoxy)cyclohexa-1,5-dien-1-yl]-1,2,4-oxadiazol-3-yl]-2,3-dihydro-1H-pyrrolo[1,2-a]indol-3-yl]acetic acid |
|---|---|
| PubChem CID | 143838254 |
| Molecular Formula | C23H17F3N4O4 |
| Molecular Weight | 470.41 g/mol |
| Exact Mass | 470.12 |
| IUPAC Name | 2-[6-[5-[5-cyano-3-(trifluoromethoxy)cyclohexa-1,5-dien-1-yl]-1,2,4-oxadiazol-3-yl]-2,3-dihydro-1H-pyrrolo[1,2-a]indol-3-yl]acetic acid |
| SMILES | N#CC1=CC(c2nc(-c3ccc4c(c3)cc3n4CCC3CC(=O)O)no2)=CC(OC(F)(F)F)C1 |
| InChI | InChI=1S/C23H17F3N4O4/c24-23(25,26)33-17-6-12(11-27)5-16(8-17)22-28-21(29-34-22)14-1-2-18-15(7-14)9-19-13(10-20(31)32)3-4-30(18)19/h1-2,5,7-9,13,17H,3-4,6,10H2,(H,31,32) |
| InChIKey | SVBMXKLVGZUFFQ-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 114.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.41 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |