C8H16BN3O5 — CID 87891784
[(2S)-5-amino-2-(ethylcarbamoylamino)-5-oxopentanoyl]boronic acid (PubChem CID 87891784) has the molecular formula C8H16BN3O5 and a molecular weight of 245.04 g/mol. Its IUPAC name is [(2S)-5-amino-2-(ethylcarbamoylamino)-5-oxopentanoyl]boronic acid.
| Compound Name | [(2S)-5-amino-2-(ethylcarbamoylamino)-5-oxopentanoyl]boronic acid |
|---|---|
| PubChem CID | 87891784 |
| Molecular Formula | C8H16BN3O5 |
| Molecular Weight | 245.04 g/mol |
| Exact Mass | 245.12 |
| IUPAC Name | [(2S)-5-amino-2-(ethylcarbamoylamino)-5-oxopentanoyl]boronic acid |
| SMILES | CCNC(=O)N[C@@H](CCC(N)=O)C(=O)B(O)O |
| InChI | InChI=1S/C8H16BN3O5/c1-2-11-8(15)12-5(3-4-6(10)13)7(14)9(16)17/h5,16-17H,2-4H2,1H3,(H2,10,13)(H2,11,12,15)/t5-/m0/s1 |
| InChIKey | YGSQPIZXWDQMAV-YFKPBYRVSA-N |
| XLogP | -2.48 |
| TPSA | 141.75 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.04 |
| LogP ≤ 5 | -2.48 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|