C16H33NO6S — CID 87892363
(2R,3S,4S,5R,6S)-2-(hydroxymethyl)-6-(2-octoxyethylamino)sulfanyloxane-3,4,5-triol (PubChem CID 87892363) has the molecular formula C16H33NO6S and a molecular weight of 367.51 g/mol. Its IUPAC name is (2R,3S,4S,5R,6S)-2-(hydroxymethyl)-6-(2-octoxyethylamino)sulfanyloxane-3,4,5-triol.
| Compound Name | (2R,3S,4S,5R,6S)-2-(hydroxymethyl)-6-(2-octoxyethylamino)sulfanyloxane-3,4,5-triol |
|---|---|
| PubChem CID | 87892363 |
| Molecular Formula | C16H33NO6S |
| Molecular Weight | 367.51 g/mol |
| Exact Mass | 367.20 |
| IUPAC Name | (2R,3S,4S,5R,6S)-2-(hydroxymethyl)-6-(2-octoxyethylamino)sulfanyloxane-3,4,5-triol |
| SMILES | CCCCCCCCOCCNS[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C16H33NO6S/c1-2-3-4-5-6-7-9-22-10-8-17-24-16-15(21)14(20)13(19)12(11-18)23-16/h12-21H,2-11H2,1H3/t12-,13-,14+,15-,16+/m1/s1 |
| InChIKey | ZVRMIZCAHJKVOU-LJIZCISZSA-N |
| XLogP | 0.40 |
| TPSA | 111.41 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.51 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|