C24H32N3O2+ — CID 8789372
[2-(2-ethylanilino)-2-oxoethyl]-methyl-[(1S)-2-oxo-1-phenyl-2-piperidin-1-ylethyl]azanium (PubChem CID 8789372) has the molecular formula C24H32N3O2+ and a molecular weight of 394.54 g/mol. Its IUPAC name is [2-(2-ethylanilino)-2-oxoethyl]-methyl-[(1S)-2-oxo-1-phenyl-2-piperidin-1-ylethyl]azanium.
| Compound Name | [2-(2-ethylanilino)-2-oxoethyl]-methyl-[(1S)-2-oxo-1-phenyl-2-piperidin-1-ylethyl]azanium |
|---|---|
| PubChem CID | 8789372 |
| Molecular Formula | C24H32N3O2+ |
| Molecular Weight | 394.54 g/mol |
| Exact Mass | 394.25 |
| IUPAC Name | [2-(2-ethylanilino)-2-oxoethyl]-methyl-[(1S)-2-oxo-1-phenyl-2-piperidin-1-ylethyl]azanium |
| SMILES | CCc1ccccc1NC(=O)C[NH+](C)[C@H](C(=O)N1CCCCC1)c1ccccc1 |
| InChI | InChI=1S/C24H31N3O2/c1-3-19-12-8-9-15-21(19)25-22(28)18-26(2)23(20-13-6-4-7-14-20)24(29)27-16-10-5-11-17-27/h4,6-9,12-15,23H,3,5,10-11,16-18H2,1-2H3,(H,25,28)/p+1/t23-/m0/s1 |
| InChIKey | XFHILJKUPHHOLB-QHCPKHFHSA-O |
| XLogP | 2.46 |
| TPSA | 53.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.54 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |