C23H25F3N2O7S — CID 87897684
(2-methoxy-5-methylphenyl) 7-(piperazin-1-ylmethyl)-1-benzofuran-5-sulfonate;2,2,2-trifluoroacetic acid (PubChem CID 87897684) has the molecular formula C23H25F3N2O7S and a molecular weight of 530.52 g/mol. Its IUPAC name is (2-methoxy-5-methylphenyl) 7-(piperazin-1-ylmethyl)-1-benzofuran-5-sulfonate;2,2,2-trifluoroacetic acid.
| Compound Name | (2-methoxy-5-methylphenyl) 7-(piperazin-1-ylmethyl)-1-benzofuran-5-sulfonate;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 87897684 |
| Molecular Formula | C23H25F3N2O7S |
| Molecular Weight | 530.52 g/mol |
| Exact Mass | 530.13 |
| IUPAC Name | (2-methoxy-5-methylphenyl) 7-(piperazin-1-ylmethyl)-1-benzofuran-5-sulfonate;2,2,2-trifluoroacetic acid |
| SMILES | COc1ccc(C)cc1OS(=O)(=O)c1cc(CN2CCNCC2)c2occc2c1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C21H24N2O5S.C2HF3O2/c1-15-3-4-19(26-2)20(11-15)28-29(24,25)18-12-16-5-10-27-21(16)17(13-18)14-23-8-6-22-7-9-23;3-2(4,5)1(6)7/h3-5,10-13,22H,6-9,14H2,1-2H3;(H,6,7) |
| InChIKey | RAYWDKUEFVIYOQ-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 118.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.52 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|