C34H40N4O3S — CID 87899893
tert-butyl N-[1-oxo-1-[(5-propan-2-yl-1,3-thiazol-2-yl)amino]-4-(tritylamino)butan-2-yl]carbamate (PubChem CID 87899893) has the molecular formula C34H40N4O3S and a molecular weight of 584.79 g/mol. Its IUPAC name is tert-butyl N-[1-oxo-1-[(5-propan-2-yl-1,3-thiazol-2-yl)amino]-4-(tritylamino)butan-2-yl]carbamate.
| Compound Name | tert-butyl N-[1-oxo-1-[(5-propan-2-yl-1,3-thiazol-2-yl)amino]-4-(tritylamino)butan-2-yl]carbamate |
|---|---|
| PubChem CID | 87899893 |
| Molecular Formula | C34H40N4O3S |
| Molecular Weight | 584.79 g/mol |
| Exact Mass | 584.28 |
| IUPAC Name | tert-butyl N-[1-oxo-1-[(5-propan-2-yl-1,3-thiazol-2-yl)amino]-4-(tritylamino)butan-2-yl]carbamate |
| SMILES | CC(C)c1cnc(NC(=O)C(CCNC(c2ccccc2)(c2ccccc2)c2ccccc2)NC(=O)OC(C)(C)C)s1 |
| InChI | InChI=1S/C34H40N4O3S/c1-24(2)29-23-35-31(42-29)38-30(39)28(37-32(40)41-33(3,4)5)21-22-36-34(25-15-9-6-10-16-25,26-17-11-7-12-18-26)27-19-13-8-14-20-27/h6-20,23-24,28,36H,21-22H2,1-5H3,(H,37,40)(H,35,38,39) |
| InChIKey | MLCZXKMXUCQKNG-UHFFFAOYSA-N |
| XLogP | 7.07 |
| TPSA | 92.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.79 |
| LogP ≤ 5 | 7.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|