About tris(butan-1-ol);2-methylbutane;titanium
tris(butan-1-ol);2-methylbutane;titanium (PubChem CID 87900303) has the molecular formula C17H41O3Ti-
and a molecular weight of 341.38 g/mol. Its IUPAC name is tris(butan-1-ol);2-methylbutane;titanium.
Molecular Properties
| Compound Name | tris(butan-1-ol);2-methylbutane;titanium |
| PubChem CID | 87900303 |
| Molecular Formula | C17H41O3Ti- |
| Molecular Weight | 341.38 g/mol |
| Exact Mass | 341.25 |
| IUPAC Name | tris(butan-1-ol);2-methylbutane;titanium |
| SMILES | CCCCO.CCCCO.CCCCO.CC[C-](C)C.[Ti] |
| InChI | InChI=1S/C5H11.3C4H10O.Ti/c1-4-5(2)3;3*1-2-3-4-5;/h4H2,1-3H3;3*5H,2-4H2,1H3;/q-1;;;; |
| InChIKey | MAVJVXXTLMGPHW-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 341.38 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze tris(butan-1-ol);2-methylbutane;titanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tris(butan-1-ol);2-methylbutane;titanium?
The IUPAC name of tris(butan-1-ol);2-methylbutane;titanium (CID 87900303) is tris(butan-1-ol);2-methylbutane;titanium.
What is the SMILES notation for tris(butan-1-ol);2-methylbutane;titanium?
The canonical SMILES for tris(butan-1-ol);2-methylbutane;titanium is CCCCO.CCCCO.CCCCO.CC[C-](C)C.[Ti].
What is the InChIKey of tris(butan-1-ol);2-methylbutane;titanium?
The InChIKey is MAVJVXXTLMGPHW-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H11.3C4H10O.Ti/c1-4-5(2)3;3*1-2-3-4-5;/h4H2,1-3H3;3*5H,2-4H2,1H3;/q-1;;;;.
What are the key properties of tris(butan-1-ol);2-methylbutane;titanium?
tris(butan-1-ol);2-methylbutane;titanium has a molecular weight of 341.38 g/mol, XLogP of 4.34, 7 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for tris(butan-1-ol);2-methylbutane;titanium is sourced from PubChem (CID 87900303), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).