C13H20N2 — CID 87901391
4-[2-[(5R)-2,2-dideuterio-5-(deuteriomethyl)pyrrolidin-1-yl]ethyl]aniline (PubChem CID 87901391) has the molecular formula C13H20N2 and a molecular weight of 207.34 g/mol. Its IUPAC name is 4-[2-[(5R)-2,2-dideuterio-5-(deuteriomethyl)pyrrolidin-1-yl]ethyl]aniline.
| Compound Name | 4-[2-[(5R)-2,2-dideuterio-5-(deuteriomethyl)pyrrolidin-1-yl]ethyl]aniline |
|---|---|
| PubChem CID | 87901391 |
| Molecular Formula | C13H20N2 |
| Molecular Weight | 207.34 g/mol |
| Exact Mass | 207.18 |
| IUPAC Name | 4-[2-[(5R)-2,2-dideuterio-5-(deuteriomethyl)pyrrolidin-1-yl]ethyl]aniline |
| SMILES | [2H]C[C@@H]1CCC([2H])([2H])N1CCc1ccc(N)cc1 |
| InChI | InChI=1S/C13H20N2/c1-11-3-2-9-15(11)10-8-12-4-6-13(14)7-5-12/h4-7,11H,2-3,8-10,14H2,1H3/t11-/m1/s1/i1D,9D2 |
| InChIKey | IHMOPGZWSJSUFU-NUSGMDNFSA-N |
| XLogP | 2.30 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.34 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|