C24H21IN2O5 — CID 87903496
2-oxo-3-phenyliodonio-1-[(3,4,5-trimethoxyphenyl)methyl]-1,8-naphthyridin-4-olate (PubChem CID 87903496) has the molecular formula C24H21IN2O5 and a molecular weight of 544.35 g/mol. Its IUPAC name is 2-oxo-3-phenyliodonio-1-[(3,4,5-trimethoxyphenyl)methyl]-1,8-naphthyridin-4-olate.
| Compound Name | 2-oxo-3-phenyliodonio-1-[(3,4,5-trimethoxyphenyl)methyl]-1,8-naphthyridin-4-olate |
|---|---|
| PubChem CID | 87903496 |
| Molecular Formula | C24H21IN2O5 |
| Molecular Weight | 544.35 g/mol |
| Exact Mass | 544.05 |
| IUPAC Name | 2-oxo-3-phenyliodonio-1-[(3,4,5-trimethoxyphenyl)methyl]-1,8-naphthyridin-4-olate |
| SMILES | COc1cc(Cn2c(=O)c([I+]c3ccccc3)c([O-])c3cccnc32)cc(OC)c1OC |
| InChI | InChI=1S/C24H21IN2O5/c1-30-18-12-15(13-19(31-2)22(18)32-3)14-27-23-17(10-7-11-26-23)21(28)20(24(27)29)25-16-8-5-4-6-9-16/h4-13H,14H2,1-3H3 |
| InChIKey | RFWWXDAIWZFDBW-UHFFFAOYSA-N |
| XLogP | -0.33 |
| TPSA | 85.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.35 |
| LogP ≤ 5 | -0.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|