C25H27F3N4O5S2 — CID 87906869
N-[1-[(3aR,7aR)-3a,4,5,6,7,7a-hexahydro-1H-benzimidazol-2-yl]-2-[4-(1,1,3-trioxo-1,2-thiazolidin-5-yl)phenyl]ethyl]-3-(trifluoromethyl)benzenesulfonamide (PubChem CID 87906869) has the molecular formula C25H27F3N4O5S2 and a molecular weight of 584.64 g/mol. Its IUPAC name is N-[1-[(3aR,7aR)-3a,4,5,6,7,7a-hexahydro-1H-benzimidazol-2-yl]-2-[4-(1,1,3-trioxo-1,2-thiazolidin-5-yl)phenyl]ethyl]-3-(trifluoromethyl)benzenesulfonamide.
| Compound Name | N-[1-[(3aR,7aR)-3a,4,5,6,7,7a-hexahydro-1H-benzimidazol-2-yl]-2-[4-(1,1,3-trioxo-1,2-thiazolidin-5-yl)phenyl]ethyl]-3-(trifluoromethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 87906869 |
| Molecular Formula | C25H27F3N4O5S2 |
| Molecular Weight | 584.64 g/mol |
| Exact Mass | 584.14 |
| IUPAC Name | N-[1-[(3aR,7aR)-3a,4,5,6,7,7a-hexahydro-1H-benzimidazol-2-yl]-2-[4-(1,1,3-trioxo-1,2-thiazolidin-5-yl)phenyl]ethyl]-3-(trifluoromethyl)benzenesulfonamide |
| SMILES | O=C1CC(c2ccc(CC(NS(=O)(=O)c3cccc(C(F)(F)F)c3)C3=N[C@@H]4CCCC[C@H]4N3)cc2)S(=O)(=O)N1 |
| InChI | InChI=1S/C25H27F3N4O5S2/c26-25(27,28)17-4-3-5-18(13-17)38(34,35)31-21(24-29-19-6-1-2-7-20(19)30-24)12-15-8-10-16(11-9-15)22-14-23(33)32-39(22,36)37/h3-5,8-11,13,19-22,31H,1-2,6-7,12,14H2,(H,29,30)(H,32,33)/t19-,20-,21?,22?/m1/s1 |
| InChIKey | XPSGWVVNHHGCGL-JTVPBKEVSA-N |
| XLogP | 2.80 |
| TPSA | 133.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.64 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |