C15H16N4O5 — CID 87907938
2-[[(4-cyanophenyl)methyl-methoxycarbamoyl]amino]-5-methyl-5H-1,2-oxazole-3-carboxylic acid (PubChem CID 87907938) has the molecular formula C15H16N4O5 and a molecular weight of 332.32 g/mol. Its IUPAC name is 2-[[(4-cyanophenyl)methyl-methoxycarbamoyl]amino]-5-methyl-5H-1,2-oxazole-3-carboxylic acid.
| Compound Name | 2-[[(4-cyanophenyl)methyl-methoxycarbamoyl]amino]-5-methyl-5H-1,2-oxazole-3-carboxylic acid |
|---|---|
| PubChem CID | 87907938 |
| Molecular Formula | C15H16N4O5 |
| Molecular Weight | 332.32 g/mol |
| Exact Mass | 332.11 |
| IUPAC Name | 2-[[(4-cyanophenyl)methyl-methoxycarbamoyl]amino]-5-methyl-5H-1,2-oxazole-3-carboxylic acid |
| SMILES | CON(Cc1ccc(C#N)cc1)C(=O)NN1OC(C)C=C1C(=O)O |
| InChI | InChI=1S/C15H16N4O5/c1-10-7-13(14(20)21)19(24-10)17-15(22)18(23-2)9-12-5-3-11(8-16)4-6-12/h3-7,10H,9H2,1-2H3,(H,17,22)(H,20,21) |
| InChIKey | VARVESFVGIAUDC-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 115.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.32 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|