About ethylamino N'-[4-(trifluoromethyl)pyridine-3-carbonyl]carbamimidothioate
ethylamino N'-[4-(trifluoromethyl)pyridine-3-carbonyl]carbamimidothioate (PubChem CID 87908301) has the molecular formula C10H11F3N4OS
and a molecular weight of 292.29 g/mol. Its IUPAC name is ethylamino N'-[4-(trifluoromethyl)pyridine-3-carbonyl]carbamimidothioate.
Molecular Properties
| Compound Name | ethylamino N'-[4-(trifluoromethyl)pyridine-3-carbonyl]carbamimidothioate |
| PubChem CID | 87908301 |
| Molecular Formula | C10H11F3N4OS |
| Molecular Weight | 292.29 g/mol |
| Exact Mass | 292.06 |
| IUPAC Name | ethylamino N'-[4-(trifluoromethyl)pyridine-3-carbonyl]carbamimidothioate |
| SMILES | CCNS/C(N)=N/C(=O)c1cnccc1C(F)(F)F |
| InChI | InChI=1S/C10H11F3N4OS/c1-2-16-19-9(14)17-8(18)6-5-15-4-3-7(6)10(11,12)13/h3-5,16H,2H2,1H3,(H2,14,17,18) |
| InChIKey | PGAYTXBCWDPDOT-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 80.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 292.29 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze ethylamino N'-[4-(trifluoromethyl)pyridine-3-carbonyl]carbamimidothioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethylamino N'-[4-(trifluoromethyl)pyridine-3-carbonyl]carbamimidothioate?
The IUPAC name of ethylamino N'-[4-(trifluoromethyl)pyridine-3-carbonyl]carbamimidothioate (CID 87908301) is ethylamino N'-[4-(trifluoromethyl)pyridine-3-carbonyl]carbamimidothioate.
What is the SMILES notation for ethylamino N'-[4-(trifluoromethyl)pyridine-3-carbonyl]carbamimidothioate?
The canonical SMILES for ethylamino N'-[4-(trifluoromethyl)pyridine-3-carbonyl]carbamimidothioate is CCNS/C(N)=N/C(=O)c1cnccc1C(F)(F)F.
What is the InChIKey of ethylamino N'-[4-(trifluoromethyl)pyridine-3-carbonyl]carbamimidothioate?
The InChIKey is PGAYTXBCWDPDOT-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11F3N4OS/c1-2-16-19-9(14)17-8(18)6-5-15-4-3-7(6)10(11,12)13/h3-5,16H,2H2,1H3,(H2,14,17,18).
What are the key properties of ethylamino N'-[4-(trifluoromethyl)pyridine-3-carbonyl]carbamimidothioate?
ethylamino N'-[4-(trifluoromethyl)pyridine-3-carbonyl]carbamimidothioate has a molecular weight of 292.29 g/mol, XLogP of 1.81, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethylamino N'-[4-(trifluoromethyl)pyridine-3-carbonyl]carbamimidothioate is sourced from PubChem (CID 87908301), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).