C10H11F3N4OS — CID 87908301
ethylamino N'-[4-(trifluoromethyl)pyridine-3-carbonyl]carbamimidothioate (PubChem CID 87908301) has the molecular formula C10H11F3N4OS and a molecular weight of 292.29 g/mol. Its IUPAC name is ethylamino N'-[4-(trifluoromethyl)pyridine-3-carbonyl]carbamimidothioate.
| Compound Name | ethylamino N'-[4-(trifluoromethyl)pyridine-3-carbonyl]carbamimidothioate |
|---|---|
| PubChem CID | 87908301 |
| Molecular Formula | C10H11F3N4OS |
| Molecular Weight | 292.29 g/mol |
| Exact Mass | 292.06 |
| IUPAC Name | ethylamino N'-[4-(trifluoromethyl)pyridine-3-carbonyl]carbamimidothioate |
| SMILES | CCNS/C(N)=N/C(=O)c1cnccc1C(F)(F)F |
| InChI | InChI=1S/C10H11F3N4OS/c1-2-16-19-9(14)17-8(18)6-5-15-4-3-7(6)10(11,12)13/h3-5,16H,2H2,1H3,(H2,14,17,18) |
| InChIKey | PGAYTXBCWDPDOT-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 80.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.29 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|