C28H36N2Ni — CID 87910945
N'-(3,5-dimethylphenyl)-N-(2-dodec-3-ynylphenyl)ethane-1,2-diimine;nickel (PubChem CID 87910945) has the molecular formula C28H36N2Ni and a molecular weight of 459.30 g/mol. Its IUPAC name is N'-(3,5-dimethylphenyl)-N-(2-dodec-3-ynylphenyl)ethane-1,2-diimine;nickel.
| Compound Name | N'-(3,5-dimethylphenyl)-N-(2-dodec-3-ynylphenyl)ethane-1,2-diimine;nickel |
|---|---|
| PubChem CID | 87910945 |
| Molecular Formula | C28H36N2Ni |
| Molecular Weight | 459.30 g/mol |
| Exact Mass | 458.22 |
| IUPAC Name | N'-(3,5-dimethylphenyl)-N-(2-dodec-3-ynylphenyl)ethane-1,2-diimine;nickel |
| SMILES | CCCCCCCCC#CCCc1ccccc1/N=C/C=N/c1cc(C)cc(C)c1.[Ni] |
| InChI | InChI=1S/C28H36N2.Ni/c1-4-5-6-7-8-9-10-11-12-13-16-26-17-14-15-18-28(26)30-20-19-29-27-22-24(2)21-25(3)23-27;/h14-15,17-23H,4-10,13,16H2,1-3H3;/b29-19+,30-20+; |
| InChIKey | WNNLFKVMAKHLJB-UMMVYMHASA-N |
| XLogP | 8.09 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.30 |
| LogP ≤ 5 | 8.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|