C38H58N2 — CID 87911467
6-N-(3,5-diethylphenyl)-5-N-(2-dodec-3-enylphenyl)decane-5,6-diimine (PubChem CID 87911467) has the molecular formula C38H58N2 and a molecular weight of 542.90 g/mol. Its IUPAC name is 6-N-(3,5-diethylphenyl)-5-N-(2-dodec-3-enylphenyl)decane-5,6-diimine.
| Compound Name | 6-N-(3,5-diethylphenyl)-5-N-(2-dodec-3-enylphenyl)decane-5,6-diimine |
|---|---|
| PubChem CID | 87911467 |
| Molecular Formula | C38H58N2 |
| Molecular Weight | 542.90 g/mol |
| Exact Mass | 542.46 |
| IUPAC Name | 6-N-(3,5-diethylphenyl)-5-N-(2-dodec-3-enylphenyl)decane-5,6-diimine |
| SMILES | CCCCCCCCC=CCCc1ccccc1/N=C(CCCC)/C(CCCC)=N/c1cc(CC)cc(CC)c1 |
| InChI | InChI=1S/C38H58N2/c1-6-11-14-15-16-17-18-19-20-21-24-34-25-22-23-28-36(34)40-38(27-13-8-3)37(26-12-7-2)39-35-30-32(9-4)29-33(10-5)31-35/h19-20,22-23,25,28-31H,6-18,21,24,26-27H2,1-5H3/b20-19?,39-37+,40-38+ |
| InChIKey | DVJOBLZYORDTBL-YQRPIPLYSA-N |
| XLogP | 12.28 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.90 |
| LogP ≤ 5 | 12.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|