C40H60N2NiO4 — CID 87912142
5-[4-[10-(3,5-dimethylphenyl)iminohenicos-11-yn-9-ylideneamino]phenyl]pentane-1,2,3,4-tetrol;nickel (PubChem CID 87912142) has the molecular formula C40H60N2NiO4 and a molecular weight of 691.62 g/mol. Its IUPAC name is 5-[4-[10-(3,5-dimethylphenyl)iminohenicos-11-yn-9-ylideneamino]phenyl]pentane-1,2,3,4-tetrol;nickel.
| Compound Name | 5-[4-[10-(3,5-dimethylphenyl)iminohenicos-11-yn-9-ylideneamino]phenyl]pentane-1,2,3,4-tetrol;nickel |
|---|---|
| PubChem CID | 87912142 |
| Molecular Formula | C40H60N2NiO4 |
| Molecular Weight | 691.62 g/mol |
| Exact Mass | 690.39 |
| IUPAC Name | 5-[4-[10-(3,5-dimethylphenyl)iminohenicos-11-yn-9-ylideneamino]phenyl]pentane-1,2,3,4-tetrol;nickel |
| SMILES | CCCCCCCCCC#CC(=N\c1cc(C)cc(C)c1)/C(CCCCCCCC)=N/c1ccc(CC(O)C(O)C(O)CO)cc1.[Ni] |
| InChI | InChI=1S/C40H60N2O4.Ni/c1-5-7-9-11-13-14-15-17-19-21-37(42-35-27-31(3)26-32(4)28-35)36(20-18-16-12-10-8-6-2)41-34-24-22-33(23-25-34)29-38(44)40(46)39(45)30-43;/h22-28,38-40,43-46H,5-18,20,29-30H2,1-4H3;/b41-36+,42-37+; |
| InChIKey | JEAGRWOGPOEGHJ-APWFGHLVSA-N |
| XLogP | 8.66 |
| TPSA | 105.64 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 691.62 |
| LogP ≤ 5 | 8.66 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|