C11H11F2N3O — CID 87913019
(2S)-2-amino-N-(cyanomethyl)-3-(2,6-difluorophenyl)propanamide (PubChem CID 87913019) has the molecular formula C11H11F2N3O and a molecular weight of 239.22 g/mol. Its IUPAC name is (2S)-2-amino-N-(cyanomethyl)-3-(2,6-difluorophenyl)propanamide.
| Compound Name | (2S)-2-amino-N-(cyanomethyl)-3-(2,6-difluorophenyl)propanamide |
|---|---|
| PubChem CID | 87913019 |
| Molecular Formula | C11H11F2N3O |
| Molecular Weight | 239.22 g/mol |
| Exact Mass | 239.09 |
| IUPAC Name | (2S)-2-amino-N-(cyanomethyl)-3-(2,6-difluorophenyl)propanamide |
| SMILES | N#CCNC(=O)[C@@H](N)Cc1c(F)cccc1F |
| InChI | InChI=1S/C11H11F2N3O/c12-8-2-1-3-9(13)7(8)6-10(15)11(17)16-5-4-14/h1-3,10H,5-6,15H2,(H,16,17)/t10-/m0/s1 |
| InChIKey | CQBKQWZTTCYFAP-JTQLQIEISA-N |
| XLogP | 0.47 |
| TPSA | 78.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.22 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|