About 1-N-ethyl-1-N'-[1-(ethylamino)propyl]propane-1,1-diamine
1-N-ethyl-1-N'-[1-(ethylamino)propyl]propane-1,1-diamine (PubChem CID 87914276) has the molecular formula C10H25N3
and a molecular weight of 187.33 g/mol. Its IUPAC name is 1-N-ethyl-1-N'-[1-(ethylamino)propyl]propane-1,1-diamine.
Molecular Properties
| Compound Name | 1-N-ethyl-1-N'-[1-(ethylamino)propyl]propane-1,1-diamine |
| PubChem CID | 87914276 |
| Molecular Formula | C10H25N3 |
| Molecular Weight | 187.33 g/mol |
| Exact Mass | 187.20 |
| IUPAC Name | 1-N-ethyl-1-N'-[1-(ethylamino)propyl]propane-1,1-diamine |
| SMILES | CCNC(CC)NC(CC)NCC |
| InChI | InChI=1S/C10H25N3/c1-5-9(11-7-3)13-10(6-2)12-8-4/h9-13H,5-8H2,1-4H3 |
| InChIKey | HFHPCXUSPGCKQO-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 36.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.33 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 1-N-ethyl-1-N'-[1-(ethylamino)propyl]propane-1,1-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-N-ethyl-1-N'-[1-(ethylamino)propyl]propane-1,1-diamine?
The IUPAC name of 1-N-ethyl-1-N'-[1-(ethylamino)propyl]propane-1,1-diamine (CID 87914276) is 1-N-ethyl-1-N'-[1-(ethylamino)propyl]propane-1,1-diamine.
What is the SMILES notation for 1-N-ethyl-1-N'-[1-(ethylamino)propyl]propane-1,1-diamine?
The canonical SMILES for 1-N-ethyl-1-N'-[1-(ethylamino)propyl]propane-1,1-diamine is CCNC(CC)NC(CC)NCC.
What is the InChIKey of 1-N-ethyl-1-N'-[1-(ethylamino)propyl]propane-1,1-diamine?
The InChIKey is HFHPCXUSPGCKQO-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H25N3/c1-5-9(11-7-3)13-10(6-2)12-8-4/h9-13H,5-8H2,1-4H3.
What are the key properties of 1-N-ethyl-1-N'-[1-(ethylamino)propyl]propane-1,1-diamine?
1-N-ethyl-1-N'-[1-(ethylamino)propyl]propane-1,1-diamine has a molecular weight of 187.33 g/mol, XLogP of 1.27, 8 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-N-ethyl-1-N'-[1-(ethylamino)propyl]propane-1,1-diamine is sourced from PubChem (CID 87914276), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).