C25H35N3O4S2 — CID 87916665
[(2R)-2-benzyl-3-[[(1S)-1-[4-(methanesulfonamido)phenyl]ethyl]carbamothioylamino]propyl] 2,2-dimethylpropanoate (PubChem CID 87916665) has the molecular formula C25H35N3O4S2 and a molecular weight of 505.71 g/mol. Its IUPAC name is [(2R)-2-benzyl-3-[[(1S)-1-[4-(methanesulfonamido)phenyl]ethyl]carbamothioylamino]propyl] 2,2-dimethylpropanoate.
| Compound Name | [(2R)-2-benzyl-3-[[(1S)-1-[4-(methanesulfonamido)phenyl]ethyl]carbamothioylamino]propyl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 87916665 |
| Molecular Formula | C25H35N3O4S2 |
| Molecular Weight | 505.71 g/mol |
| Exact Mass | 505.21 |
| IUPAC Name | [(2R)-2-benzyl-3-[[(1S)-1-[4-(methanesulfonamido)phenyl]ethyl]carbamothioylamino]propyl] 2,2-dimethylpropanoate |
| SMILES | C[C@H](NC(=S)NC[C@H](COC(=O)C(C)(C)C)Cc1ccccc1)c1ccc(NS(C)(=O)=O)cc1 |
| InChI | InChI=1S/C25H35N3O4S2/c1-18(21-11-13-22(14-12-21)28-34(5,30)31)27-24(33)26-16-20(15-19-9-7-6-8-10-19)17-32-23(29)25(2,3)4/h6-14,18,20,28H,15-17H2,1-5H3,(H2,26,27,33)/t18-,20+/m0/s1 |
| InChIKey | FUWADUJDKJZYPA-AZUAARDMSA-N |
| XLogP | 4.03 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.71 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|