C24H33N3O4S2 — CID 86298691
[(2R)-2-[[(1R)-1-[4-(methanesulfonamido)phenyl]ethyl]carbamothioylamino]-3-phenylpropyl] 2,2-dimethylpropanoate (PubChem CID 86298691) has the molecular formula C24H33N3O4S2 and a molecular weight of 491.68 g/mol. Its IUPAC name is [(2R)-2-[[(1R)-1-[4-(methanesulfonamido)phenyl]ethyl]carbamothioylamino]-3-phenylpropyl] 2,2-dimethylpropanoate.
| Compound Name | [(2R)-2-[[(1R)-1-[4-(methanesulfonamido)phenyl]ethyl]carbamothioylamino]-3-phenylpropyl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 86298691 |
| Molecular Formula | C24H33N3O4S2 |
| Molecular Weight | 491.68 g/mol |
| Exact Mass | 491.19 |
| IUPAC Name | [(2R)-2-[[(1R)-1-[4-(methanesulfonamido)phenyl]ethyl]carbamothioylamino]-3-phenylpropyl] 2,2-dimethylpropanoate |
| SMILES | C[C@@H](NC(=S)N[C@@H](COC(=O)C(C)(C)C)Cc1ccccc1)c1ccc(NS(C)(=O)=O)cc1 |
| InChI | InChI=1S/C24H33N3O4S2/c1-17(19-11-13-20(14-12-19)27-33(5,29)30)25-23(32)26-21(15-18-9-7-6-8-10-18)16-31-22(28)24(2,3)4/h6-14,17,21,27H,15-16H2,1-5H3,(H2,25,26,32)/t17-,21-/m1/s1 |
| InChIKey | FLZIMWQQPVNOQB-DYESRHJHSA-N |
| XLogP | 3.78 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.68 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|