C33H45N3O3SSi — CID 10698683
ethyl N-[(1S,2S)-2-[[(2S)-1-[tert-butyl(dimethyl)silyl]oxy-3-phenylpropan-2-yl]carbamothioylamino]-1,2-diphenylethyl]carbamate (PubChem CID 10698683) has the molecular formula C33H45N3O3SSi and a molecular weight of 591.89 g/mol. Its IUPAC name is ethyl N-[(1S,2S)-2-[[(2S)-1-[tert-butyl(dimethyl)silyl]oxy-3-phenylpropan-2-yl]carbamothioylamino]-1,2-diphenylethyl]carbamate.
| Compound Name | ethyl N-[(1S,2S)-2-[[(2S)-1-[tert-butyl(dimethyl)silyl]oxy-3-phenylpropan-2-yl]carbamothioylamino]-1,2-diphenylethyl]carbamate |
|---|---|
| PubChem CID | 10698683 |
| Molecular Formula | C33H45N3O3SSi |
| Molecular Weight | 591.89 g/mol |
| Exact Mass | 591.30 |
| IUPAC Name | ethyl N-[(1S,2S)-2-[[(2S)-1-[tert-butyl(dimethyl)silyl]oxy-3-phenylpropan-2-yl]carbamothioylamino]-1,2-diphenylethyl]carbamate |
| SMILES | CCOC(=O)N[C@@H](c1ccccc1)[C@@H](NC(=S)N[C@H](CO[Si](C)(C)C(C)(C)C)Cc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C33H45N3O3SSi/c1-7-38-32(37)36-30(27-21-15-10-16-22-27)29(26-19-13-9-14-20-26)35-31(40)34-28(23-25-17-11-8-12-18-25)24-39-41(5,6)33(2,3)4/h8-22,28-30H,7,23-24H2,1-6H3,(H,36,37)(H2,34,35,40)/t28-,29-,30-/m0/s1 |
| InChIKey | NKGFHWYWSAXNDC-DTXPUJKBSA-N |
| XLogP | 7.31 |
| TPSA | 71.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.89 |
| LogP ≤ 5 | 7.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|