C22H30N4O5S — CID 87917025
N-hydroxy-2-(4-phenylmethoxypiperidin-1-yl)sulfonyl-N-(4-pyrimidin-2-ylbutyl)acetamide (PubChem CID 87917025) has the molecular formula C22H30N4O5S and a molecular weight of 462.57 g/mol. Its IUPAC name is N-hydroxy-2-(4-phenylmethoxypiperidin-1-yl)sulfonyl-N-(4-pyrimidin-2-ylbutyl)acetamide.
| Compound Name | N-hydroxy-2-(4-phenylmethoxypiperidin-1-yl)sulfonyl-N-(4-pyrimidin-2-ylbutyl)acetamide |
|---|---|
| PubChem CID | 87917025 |
| Molecular Formula | C22H30N4O5S |
| Molecular Weight | 462.57 g/mol |
| Exact Mass | 462.19 |
| IUPAC Name | N-hydroxy-2-(4-phenylmethoxypiperidin-1-yl)sulfonyl-N-(4-pyrimidin-2-ylbutyl)acetamide |
| SMILES | O=C(CS(=O)(=O)N1CCC(OCc2ccccc2)CC1)N(O)CCCCc1ncccn1 |
| InChI | InChI=1S/C22H30N4O5S/c27-22(26(28)14-5-4-9-21-23-12-6-13-24-21)18-32(29,30)25-15-10-20(11-16-25)31-17-19-7-2-1-3-8-19/h1-3,6-8,12-13,20,28H,4-5,9-11,14-18H2 |
| InChIKey | NRORPSOYFGIXOJ-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 112.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.57 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|