C28H39N3O8S — CID 87919340
[(3aS,4R,6aR)-2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-yl]-[(2S,3R)-4-[(3-aminophenyl)sulfonyl-pentan-3-yloxyamino]-3-hydroxy-1-phenylbutan-2-yl]carbamic acid (PubChem CID 87919340) has the molecular formula C28H39N3O8S and a molecular weight of 577.70 g/mol. Its IUPAC name is [(3aS,4R,6aR)-2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-yl]-[(2S,3R)-4-[(3-aminophenyl)sulfonyl-pentan-3-yloxyamino]-3-hydroxy-1-phenylbutan-2-yl]carbamic acid.
| Compound Name | [(3aS,4R,6aR)-2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-yl]-[(2S,3R)-4-[(3-aminophenyl)sulfonyl-pentan-3-yloxyamino]-3-hydroxy-1-phenylbutan-2-yl]carbamic acid |
|---|---|
| PubChem CID | 87919340 |
| Molecular Formula | C28H39N3O8S |
| Molecular Weight | 577.70 g/mol |
| Exact Mass | 577.25 |
| IUPAC Name | [(3aS,4R,6aR)-2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-yl]-[(2S,3R)-4-[(3-aminophenyl)sulfonyl-pentan-3-yloxyamino]-3-hydroxy-1-phenylbutan-2-yl]carbamic acid |
| SMILES | CCC(CC)ON(C[C@@H](O)[C@H](Cc1ccccc1)N(C(=O)O)[C@H]1CO[C@H]2OCC[C@H]21)S(=O)(=O)c1cccc(N)c1 |
| InChI | InChI=1S/C28H39N3O8S/c1-3-21(4-2)39-30(40(35,36)22-12-8-11-20(29)16-22)17-26(32)24(15-19-9-6-5-7-10-19)31(28(33)34)25-18-38-27-23(25)13-14-37-27/h5-12,16,21,23-27,32H,3-4,13-15,17-18,29H2,1-2H3,(H,33,34)/t23-,24-,25-,26+,27+/m0/s1 |
| InChIKey | DEJTUKQEPSQDDA-AFTJIJFZSA-N |
| XLogP | 3.09 |
| TPSA | 151.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.70 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|