C36H44N2O11S — CID 20774249
2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-yl N-[4-[1,3-benzodioxol-5-ylsulfonyl(pentan-3-yloxy)amino]-3-hydroxy-1-(4-phenylmethoxyphenyl)butan-2-yl]carbamate (PubChem CID 20774249) has the molecular formula C36H44N2O11S and a molecular weight of 712.82 g/mol. Its IUPAC name is 2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-yl N-[4-[1,3-benzodioxol-5-ylsulfonyl(pentan-3-yloxy)amino]-3-hydroxy-1-(4-phenylmethoxyphenyl)butan-2-yl]carbamate.
| Compound Name | 2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-yl N-[4-[1,3-benzodioxol-5-ylsulfonyl(pentan-3-yloxy)amino]-3-hydroxy-1-(4-phenylmethoxyphenyl)butan-2-yl]carbamate |
|---|---|
| PubChem CID | 20774249 |
| Molecular Formula | C36H44N2O11S |
| Molecular Weight | 712.82 g/mol |
| Exact Mass | 712.27 |
| IUPAC Name | 2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-yl N-[4-[1,3-benzodioxol-5-ylsulfonyl(pentan-3-yloxy)amino]-3-hydroxy-1-(4-phenylmethoxyphenyl)butan-2-yl]carbamate |
| SMILES | CCC(CC)ON(CC(O)C(Cc1ccc(OCc2ccccc2)cc1)NC(=O)OC1COC2OCCC12)S(=O)(=O)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C36H44N2O11S/c1-3-26(4-2)49-38(50(41,42)28-14-15-32-33(19-28)47-23-46-32)20-31(39)30(37-36(40)48-34-22-45-35-29(34)16-17-43-35)18-24-10-12-27(13-11-24)44-21-25-8-6-5-7-9-25/h5-15,19,26,29-31,34-35,39H,3-4,16-18,20-23H2,1-2H3,(H,37,40) |
| InChIKey | ZWGLZOHNXWSMCA-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 151.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 712.82 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|