C24H28ClFN2O3 — CID 87920494
[1-[(4-chlorophenoxy)methyl]-4-[(4-fluorophenyl)methyl]-3-(2-hydroxypentyl)piperazin-2-ylidene]methanone (PubChem CID 87920494) has the molecular formula C24H28ClFN2O3 and a molecular weight of 446.95 g/mol. Its IUPAC name is [1-[(4-chlorophenoxy)methyl]-4-[(4-fluorophenyl)methyl]-3-(2-hydroxypentyl)piperazin-2-ylidene]methanone.
| Compound Name | [1-[(4-chlorophenoxy)methyl]-4-[(4-fluorophenyl)methyl]-3-(2-hydroxypentyl)piperazin-2-ylidene]methanone |
|---|---|
| PubChem CID | 87920494 |
| Molecular Formula | C24H28ClFN2O3 |
| Molecular Weight | 446.95 g/mol |
| Exact Mass | 446.18 |
| IUPAC Name | [1-[(4-chlorophenoxy)methyl]-4-[(4-fluorophenyl)methyl]-3-(2-hydroxypentyl)piperazin-2-ylidene]methanone |
| SMILES | CCCC(O)CC1C(=C=O)N(COc2ccc(Cl)cc2)CCN1Cc1ccc(F)cc1 |
| InChI | InChI=1S/C24H28ClFN2O3/c1-2-3-21(30)14-23-24(16-29)28(17-31-22-10-6-19(25)7-11-22)13-12-27(23)15-18-4-8-20(26)9-5-18/h4-11,21,23,30H,2-3,12-15,17H2,1H3 |
| InChIKey | PSPGXFXWEIYCDD-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 53.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.95 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ketene', 'substructure': 'N/A'} |
|---|