C11H20N3O3+ — CID 8792194
[(2R)-2-cyanopropyl]-[2-(ethoxycarbonylamino)-2-oxoethyl]-ethylazanium (PubChem CID 8792194) has the molecular formula C11H20N3O3+ and a molecular weight of 242.30 g/mol. Its IUPAC name is [(2R)-2-cyanopropyl]-[2-(ethoxycarbonylamino)-2-oxoethyl]-ethylazanium.
| Compound Name | [(2R)-2-cyanopropyl]-[2-(ethoxycarbonylamino)-2-oxoethyl]-ethylazanium |
|---|---|
| PubChem CID | 8792194 |
| Molecular Formula | C11H20N3O3+ |
| Molecular Weight | 242.30 g/mol |
| Exact Mass | 242.15 |
| IUPAC Name | [(2R)-2-cyanopropyl]-[2-(ethoxycarbonylamino)-2-oxoethyl]-ethylazanium |
| SMILES | CCOC(=O)NC(=O)C[NH+](CC)CC(C)C#N |
| InChI | InChI=1S/C11H19N3O3/c1-4-14(7-9(3)6-12)8-10(15)13-11(16)17-5-2/h9H,4-5,7-8H2,1-3H3,(H,13,15,16)/p+1 |
| InChIKey | NVCNNGJUMCABLR-UHFFFAOYSA-O |
| XLogP | -0.68 |
| TPSA | 83.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.30 |
| LogP ≤ 5 | -0.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |