C13H9N3O4S — CID 8792206
(5-thiophen-2-yl-1,3,4-oxadiazol-2-yl)methyl 1-oxidopyridin-1-ium-4-carboxylate (PubChem CID 8792206) has the molecular formula C13H9N3O4S and a molecular weight of 303.30 g/mol. Its IUPAC name is (5-thiophen-2-yl-1,3,4-oxadiazol-2-yl)methyl 1-oxidopyridin-1-ium-4-carboxylate.
| Compound Name | (5-thiophen-2-yl-1,3,4-oxadiazol-2-yl)methyl 1-oxidopyridin-1-ium-4-carboxylate |
|---|---|
| PubChem CID | 8792206 |
| Molecular Formula | C13H9N3O4S |
| Molecular Weight | 303.30 g/mol |
| Exact Mass | 303.03 |
| IUPAC Name | (5-thiophen-2-yl-1,3,4-oxadiazol-2-yl)methyl 1-oxidopyridin-1-ium-4-carboxylate |
| SMILES | O=C(OCc1nnc(-c2cccs2)o1)c1cc[n+]([O-])cc1 |
| InChI | InChI=1S/C13H9N3O4S/c17-13(9-3-5-16(18)6-4-9)19-8-11-14-15-12(20-11)10-2-1-7-21-10/h1-7H,8H2 |
| InChIKey | HDSYRXJTDFDLAF-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 92.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.30 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|