C13H21N3O6S — CID 87925362
(2S)-5-[[(2R)-1-(carboxymethylamino)-1-oxo-3-sulfanylpropan-2-yl]amino]-5-oxo-2-(prop-2-enylamino)pentanoic acid (PubChem CID 87925362) has the molecular formula C13H21N3O6S and a molecular weight of 347.39 g/mol. Its IUPAC name is (2S)-5-[[(2R)-1-(carboxymethylamino)-1-oxo-3-sulfanylpropan-2-yl]amino]-5-oxo-2-(prop-2-enylamino)pentanoic acid.
| Compound Name | (2S)-5-[[(2R)-1-(carboxymethylamino)-1-oxo-3-sulfanylpropan-2-yl]amino]-5-oxo-2-(prop-2-enylamino)pentanoic acid |
|---|---|
| PubChem CID | 87925362 |
| Molecular Formula | C13H21N3O6S |
| Molecular Weight | 347.39 g/mol |
| Exact Mass | 347.12 |
| IUPAC Name | (2S)-5-[[(2R)-1-(carboxymethylamino)-1-oxo-3-sulfanylpropan-2-yl]amino]-5-oxo-2-(prop-2-enylamino)pentanoic acid |
| SMILES | C=CCN[C@@H](CCC(=O)N[C@@H](CS)C(=O)NCC(=O)O)C(=O)O |
| InChI | InChI=1S/C13H21N3O6S/c1-2-5-14-8(13(21)22)3-4-10(17)16-9(7-23)12(20)15-6-11(18)19/h2,8-9,14,23H,1,3-7H2,(H,15,20)(H,16,17)(H,18,19)(H,21,22)/t8-,9-/m0/s1 |
| InChIKey | OEVARWWISQCHRI-IUCAKERBSA-N |
| XLogP | -1.39 |
| TPSA | 144.83 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.39 |
| LogP ≤ 5 | -1.39 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|