About butane-1-sulfonate;1H-imidazol-3-ium
butane-1-sulfonate;1H-imidazol-3-ium (PubChem CID 87925728) has the molecular formula C7H14N2O3S
and a molecular weight of 206.27 g/mol. Its IUPAC name is butane-1-sulfonate;1H-imidazol-3-ium.
Molecular Properties
| Compound Name | butane-1-sulfonate;1H-imidazol-3-ium |
| PubChem CID | 87925728 |
| Molecular Formula | C7H14N2O3S |
| Molecular Weight | 206.27 g/mol |
| Exact Mass | 206.07 |
| IUPAC Name | butane-1-sulfonate;1H-imidazol-3-ium |
| SMILES | CCCCS(=O)(=O)[O-].c1c[nH+]c[nH]1 |
| InChI | InChI=1S/C4H10O3S.C3H4N2/c1-2-3-4-8(5,6)7;1-2-5-3-4-1/h2-4H2,1H3,(H,5,6,7);1-3H,(H,4,5) |
| InChIKey | RKJCSBMMTVNIBT-UHFFFAOYSA-N |
| XLogP | 0.16 |
| TPSA | 87.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.27 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze butane-1-sulfonate;1H-imidazol-3-ium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butane-1-sulfonate;1H-imidazol-3-ium?
The IUPAC name of butane-1-sulfonate;1H-imidazol-3-ium (CID 87925728) is butane-1-sulfonate;1H-imidazol-3-ium.
What is the SMILES notation for butane-1-sulfonate;1H-imidazol-3-ium?
The canonical SMILES for butane-1-sulfonate;1H-imidazol-3-ium is CCCCS(=O)(=O)[O-].c1c[nH+]c[nH]1.
What is the InChIKey of butane-1-sulfonate;1H-imidazol-3-ium?
The InChIKey is RKJCSBMMTVNIBT-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H10O3S.C3H4N2/c1-2-3-4-8(5,6)7;1-2-5-3-4-1/h2-4H2,1H3,(H,5,6,7);1-3H,(H,4,5).
What are the key properties of butane-1-sulfonate;1H-imidazol-3-ium?
butane-1-sulfonate;1H-imidazol-3-ium has a molecular weight of 206.27 g/mol, XLogP of 0.16, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for butane-1-sulfonate;1H-imidazol-3-ium is sourced from PubChem (CID 87925728), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).