C17H19NO4 — CID 87926681
tert-butyl 2-amino-2-(4-formyloxynaphthalen-1-yl)acetate (PubChem CID 87926681) has the molecular formula C17H19NO4 and a molecular weight of 301.34 g/mol. Its IUPAC name is tert-butyl 2-amino-2-(4-formyloxynaphthalen-1-yl)acetate.
| Compound Name | tert-butyl 2-amino-2-(4-formyloxynaphthalen-1-yl)acetate |
|---|---|
| PubChem CID | 87926681 |
| Molecular Formula | C17H19NO4 |
| Molecular Weight | 301.34 g/mol |
| Exact Mass | 301.13 |
| IUPAC Name | tert-butyl 2-amino-2-(4-formyloxynaphthalen-1-yl)acetate |
| SMILES | CC(C)(C)OC(=O)C(N)c1ccc(OC=O)c2ccccc12 |
| InChI | InChI=1S/C17H19NO4/c1-17(2,3)22-16(20)15(18)13-8-9-14(21-10-19)12-7-5-4-6-11(12)13/h4-10,15H,18H2,1-3H3 |
| InChIKey | KEPHBVKAPGWTJG-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 78.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.34 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|