About N-(cyanomethyl)-3,3,3-trifluoro-N-pyridin-2-ylpropanamide
N-(cyanomethyl)-3,3,3-trifluoro-N-pyridin-2-ylpropanamide (PubChem CID 87929157) has the molecular formula C10H8F3N3O
and a molecular weight of 243.19 g/mol. Its IUPAC name is N-(cyanomethyl)-3,3,3-trifluoro-N-pyridin-2-ylpropanamide.
Molecular Properties
| Compound Name | N-(cyanomethyl)-3,3,3-trifluoro-N-pyridin-2-ylpropanamide |
| PubChem CID | 87929157 |
| Molecular Formula | C10H8F3N3O |
| Molecular Weight | 243.19 g/mol |
| Exact Mass | 243.06 |
| IUPAC Name | N-(cyanomethyl)-3,3,3-trifluoro-N-pyridin-2-ylpropanamide |
| SMILES | N#CCN(C(=O)CC(F)(F)F)c1ccccn1 |
| InChI | InChI=1S/C10H8F3N3O/c11-10(12,13)7-9(17)16(6-4-14)8-3-1-2-5-15-8/h1-3,5H,6-7H2 |
| InChIKey | PCKWQTNSZVJBHC-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 56.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.19 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|
Analyze N-(cyanomethyl)-3,3,3-trifluoro-N-pyridin-2-ylpropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(cyanomethyl)-3,3,3-trifluoro-N-pyridin-2-ylpropanamide?
The IUPAC name of N-(cyanomethyl)-3,3,3-trifluoro-N-pyridin-2-ylpropanamide (CID 87929157) is N-(cyanomethyl)-3,3,3-trifluoro-N-pyridin-2-ylpropanamide.
What is the SMILES notation for N-(cyanomethyl)-3,3,3-trifluoro-N-pyridin-2-ylpropanamide?
The canonical SMILES for N-(cyanomethyl)-3,3,3-trifluoro-N-pyridin-2-ylpropanamide is N#CCN(C(=O)CC(F)(F)F)c1ccccn1.
What is the InChIKey of N-(cyanomethyl)-3,3,3-trifluoro-N-pyridin-2-ylpropanamide?
The InChIKey is PCKWQTNSZVJBHC-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8F3N3O/c11-10(12,13)7-9(17)16(6-4-14)8-3-1-2-5-15-8/h1-3,5H,6-7H2.
What are the key properties of N-(cyanomethyl)-3,3,3-trifluoro-N-pyridin-2-ylpropanamide?
N-(cyanomethyl)-3,3,3-trifluoro-N-pyridin-2-ylpropanamide has a molecular weight of 243.19 g/mol, XLogP of 1.89, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(cyanomethyl)-3,3,3-trifluoro-N-pyridin-2-ylpropanamide is sourced from PubChem (CID 87929157), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).