C25H25F2N7OS — CID 87929831
3-[[4-(4-aminophenyl)triazol-1-yl]methyl]-N-[6-(2,2-difluoroethylamino)-4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl]benzamide (PubChem CID 87929831) has the molecular formula C25H25F2N7OS and a molecular weight of 509.59 g/mol. Its IUPAC name is 3-[[4-(4-aminophenyl)triazol-1-yl]methyl]-N-[6-(2,2-difluoroethylamino)-4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl]benzamide.
| Compound Name | 3-[[4-(4-aminophenyl)triazol-1-yl]methyl]-N-[6-(2,2-difluoroethylamino)-4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl]benzamide |
|---|---|
| PubChem CID | 87929831 |
| Molecular Formula | C25H25F2N7OS |
| Molecular Weight | 509.59 g/mol |
| Exact Mass | 509.18 |
| IUPAC Name | 3-[[4-(4-aminophenyl)triazol-1-yl]methyl]-N-[6-(2,2-difluoroethylamino)-4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl]benzamide |
| SMILES | Nc1ccc(-c2cn(Cc3cccc(C(=O)Nc4nc5c(s4)CC(NCC(F)F)CC5)c3)nn2)cc1 |
| InChI | InChI=1S/C25H25F2N7OS/c26-23(27)12-29-19-8-9-20-22(11-19)36-25(30-20)31-24(35)17-3-1-2-15(10-17)13-34-14-21(32-33-34)16-4-6-18(28)7-5-16/h1-7,10,14,19,23,29H,8-9,11-13,28H2,(H,30,31,35) |
| InChIKey | KZGHXSGUPOYTAB-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 110.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.59 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|