C21H26N3O3+ — CID 8793414
(4-methoxyphenyl)methyl-methyl-[2-oxo-2-[4-(2-oxopyrrolidin-1-yl)anilino]ethyl]azanium (PubChem CID 8793414) has the molecular formula C21H26N3O3+ and a molecular weight of 368.46 g/mol. Its IUPAC name is (4-methoxyphenyl)methyl-methyl-[2-oxo-2-[4-(2-oxopyrrolidin-1-yl)anilino]ethyl]azanium.
| Compound Name | (4-methoxyphenyl)methyl-methyl-[2-oxo-2-[4-(2-oxopyrrolidin-1-yl)anilino]ethyl]azanium |
|---|---|
| PubChem CID | 8793414 |
| Molecular Formula | C21H26N3O3+ |
| Molecular Weight | 368.46 g/mol |
| Exact Mass | 368.20 |
| IUPAC Name | (4-methoxyphenyl)methyl-methyl-[2-oxo-2-[4-(2-oxopyrrolidin-1-yl)anilino]ethyl]azanium |
| SMILES | COc1ccc(C[NH+](C)CC(=O)Nc2ccc(N3CCCC3=O)cc2)cc1 |
| InChI | InChI=1S/C21H25N3O3/c1-23(14-16-5-11-19(27-2)12-6-16)15-20(25)22-17-7-9-18(10-8-17)24-13-3-4-21(24)26/h5-12H,3-4,13-15H2,1-2H3,(H,22,25)/p+1 |
| InChIKey | RQRFATCUJDDYNQ-UHFFFAOYSA-O |
| XLogP | 1.48 |
| TPSA | 63.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.46 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |