C21H26N3O2+ — CID 8791101
methyl-[(2-methylphenyl)methyl]-[2-oxo-2-[4-(2-oxopyrrolidin-1-yl)anilino]ethyl]azanium (PubChem CID 8791101) has the molecular formula C21H26N3O2+ and a molecular weight of 352.46 g/mol. Its IUPAC name is methyl-[(2-methylphenyl)methyl]-[2-oxo-2-[4-(2-oxopyrrolidin-1-yl)anilino]ethyl]azanium.
| Compound Name | methyl-[(2-methylphenyl)methyl]-[2-oxo-2-[4-(2-oxopyrrolidin-1-yl)anilino]ethyl]azanium |
|---|---|
| PubChem CID | 8791101 |
| Molecular Formula | C21H26N3O2+ |
| Molecular Weight | 352.46 g/mol |
| Exact Mass | 352.20 |
| IUPAC Name | methyl-[(2-methylphenyl)methyl]-[2-oxo-2-[4-(2-oxopyrrolidin-1-yl)anilino]ethyl]azanium |
| SMILES | Cc1ccccc1C[NH+](C)CC(=O)Nc1ccc(N2CCCC2=O)cc1 |
| InChI | InChI=1S/C21H25N3O2/c1-16-6-3-4-7-17(16)14-23(2)15-20(25)22-18-9-11-19(12-10-18)24-13-5-8-21(24)26/h3-4,6-7,9-12H,5,8,13-15H2,1-2H3,(H,22,25)/p+1 |
| InChIKey | ZPWRPXRTKZQQRM-UHFFFAOYSA-O |
| XLogP | 1.78 |
| TPSA | 53.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.46 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |