C20H16Cl2NZr — CID 87935175
4-(1H-inden-1-id-2-yl)-2,3-dihydro-1H-cyclopenta[b]indole;zirconium(3+);dichloride (PubChem CID 87935175) has the molecular formula C20H16Cl2NZr and a molecular weight of 432.49 g/mol. Its IUPAC name is 4-(1H-inden-1-id-2-yl)-2,3-dihydro-1H-cyclopenta[b]indole;zirconium(3+);dichloride.
| Compound Name | 4-(1H-inden-1-id-2-yl)-2,3-dihydro-1H-cyclopenta[b]indole;zirconium(3+);dichloride |
|---|---|
| PubChem CID | 87935175 |
| Molecular Formula | C20H16Cl2NZr |
| Molecular Weight | 432.49 g/mol |
| Exact Mass | 429.97 |
| IUPAC Name | 4-(1H-inden-1-id-2-yl)-2,3-dihydro-1H-cyclopenta[b]indole;zirconium(3+);dichloride |
| SMILES | [Cl-].[Cl-].[Zr+3].c1ccc2[cH-]c(-n3c4c(c5ccccc53)CCC4)cc2c1 |
| InChI | InChI=1S/C20H16N.2ClH.Zr/c1-2-7-15-13-16(12-14(15)6-1)21-19-10-4-3-8-17(19)18-9-5-11-20(18)21;;;/h1-4,6-8,10,12-13H,5,9,11H2;2*1H;/q-1;;;+3/p-2 |
| InChIKey | FAKJFIUBHZZNMF-UHFFFAOYSA-L |
| XLogP | -1.00 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.49 |
| LogP ≤ 5 | -1.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|