About 4-(1H-inden-1-id-2-yl)-2,3-dihydro-1H-cyclopenta[b]indole;zirconium(3+);dichloride
4-(1H-inden-1-id-2-yl)-2,3-dihydro-1H-cyclopenta[b]indole;zirconium(3+);dichloride (PubChem CID 87935175) has the molecular formula C20H16Cl2NZr
and a molecular weight of 432.49 g/mol. Its IUPAC name is 4-(1H-inden-1-id-2-yl)-2,3-dihydro-1H-cyclopenta[b]indole;zirconium(3+);dichloride.
Molecular Properties
| Compound Name | 4-(1H-inden-1-id-2-yl)-2,3-dihydro-1H-cyclopenta[b]indole;zirconium(3+);dichloride |
| PubChem CID | 87935175 |
| Molecular Formula | C20H16Cl2NZr |
| Molecular Weight | 432.49 g/mol |
| Exact Mass | 429.97 |
| IUPAC Name | 4-(1H-inden-1-id-2-yl)-2,3-dihydro-1H-cyclopenta[b]indole;zirconium(3+);dichloride |
| SMILES | [Cl-].[Cl-].[Zr+3].c1ccc2[cH-]c(-n3c4c(c5ccccc53)CCC4)cc2c1 |
| InChI | InChI=1S/C20H16N.2ClH.Zr/c1-2-7-15-13-16(12-14(15)6-1)21-19-10-4-3-8-17(19)18-9-5-11-20(18)21;;;/h1-4,6-8,10,12-13H,5,9,11H2;2*1H;/q-1;;;+3/p-2 |
| InChIKey | FAKJFIUBHZZNMF-UHFFFAOYSA-L |
| XLogP | -1.00 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 432.49 |
| LogP ≤ 5 | -1.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 4-(1H-inden-1-id-2-yl)-2,3-dihydro-1H-cyclopenta[b]indole;zirconium(3+);dichloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(1H-inden-1-id-2-yl)-2,3-dihydro-1H-cyclopenta[b]indole;zirconium(3+);dichloride?
The IUPAC name of 4-(1H-inden-1-id-2-yl)-2,3-dihydro-1H-cyclopenta[b]indole;zirconium(3+);dichloride (CID 87935175) is 4-(1H-inden-1-id-2-yl)-2,3-dihydro-1H-cyclopenta[b]indole;zirconium(3+);dichloride.
What is the SMILES notation for 4-(1H-inden-1-id-2-yl)-2,3-dihydro-1H-cyclopenta[b]indole;zirconium(3+);dichloride?
The canonical SMILES for 4-(1H-inden-1-id-2-yl)-2,3-dihydro-1H-cyclopenta[b]indole;zirconium(3+);dichloride is [Cl-].[Cl-].[Zr+3].c1ccc2[cH-]c(-n3c4c(c5ccccc53)CCC4)cc2c1.
What is the InChIKey of 4-(1H-inden-1-id-2-yl)-2,3-dihydro-1H-cyclopenta[b]indole;zirconium(3+);dichloride?
The InChIKey is FAKJFIUBHZZNMF-UHFFFAOYSA-L. The full InChI is InChI=1S/C20H16N.2ClH.Zr/c1-2-7-15-13-16(12-14(15)6-1)21-19-10-4-3-8-17(19)18-9-5-11-20(18)21;;;/h1-4,6-8,10,12-13H,5,9,11H2;2*1H;/q-1;;;+3/p-2.
What are the key properties of 4-(1H-inden-1-id-2-yl)-2,3-dihydro-1H-cyclopenta[b]indole;zirconium(3+);dichloride?
4-(1H-inden-1-id-2-yl)-2,3-dihydro-1H-cyclopenta[b]indole;zirconium(3+);dichloride has a molecular weight of 432.49 g/mol, XLogP of -1.00, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(1H-inden-1-id-2-yl)-2,3-dihydro-1H-cyclopenta[b]indole;zirconium(3+);dichloride is sourced from PubChem (CID 87935175), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).