C21H18Cl2PZr — CID 87935466
5-(1H-inden-1-id-2-yl)-6,7,8,9-tetrahydrobenzo[b]phosphindole;zirconium(3+);dichloride (PubChem CID 87935466) has the molecular formula C21H18Cl2PZr and a molecular weight of 463.48 g/mol. Its IUPAC name is 5-(1H-inden-1-id-2-yl)-6,7,8,9-tetrahydrobenzo[b]phosphindole;zirconium(3+);dichloride.
| Compound Name | 5-(1H-inden-1-id-2-yl)-6,7,8,9-tetrahydrobenzo[b]phosphindole;zirconium(3+);dichloride |
|---|---|
| PubChem CID | 87935466 |
| Molecular Formula | C21H18Cl2PZr |
| Molecular Weight | 463.48 g/mol |
| Exact Mass | 460.96 |
| IUPAC Name | 5-(1H-inden-1-id-2-yl)-6,7,8,9-tetrahydrobenzo[b]phosphindole;zirconium(3+);dichloride |
| SMILES | [Cl-].[Cl-].[Zr+3].c1ccc2[cH-]c(-p3c4c(c5ccccc53)CCCC4)cc2c1 |
| InChI | InChI=1S/C21H18P.2ClH.Zr/c1-2-8-16-14-17(13-15(16)7-1)22-20-11-5-3-9-18(20)19-10-4-6-12-21(19)22;;;/h1-3,5,7-9,11,13-14H,4,6,10,12H2;2*1H;/q-1;;;+3/p-2 |
| InChIKey | PBPRLCHLZYGZHI-UHFFFAOYSA-L |
| XLogP | 0.57 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.48 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|