C25H39NOSi3 — CID 87935848
N-tert-butyl-11-[ethyl(dimethyl)silyl]-11-methyl-14-trimethylsilyloxy-11-silatetracyclo[7.5.0.02,7.010,12]tetradeca-1(9),2,4,6,10(12),13-hexaen-13-amine (PubChem CID 87935848) has the molecular formula C25H39NOSi3 and a molecular weight of 453.85 g/mol. Its IUPAC name is N-tert-butyl-11-[ethyl(dimethyl)silyl]-11-methyl-14-trimethylsilyloxy-11-silatetracyclo[7.5.0.02,7.010,12]tetradeca-1(9),2,4,6,10(12),13-hexaen-13-amine.
| Compound Name | N-tert-butyl-11-[ethyl(dimethyl)silyl]-11-methyl-14-trimethylsilyloxy-11-silatetracyclo[7.5.0.02,7.010,12]tetradeca-1(9),2,4,6,10(12),13-hexaen-13-amine |
|---|---|
| PubChem CID | 87935848 |
| Molecular Formula | C25H39NOSi3 |
| Molecular Weight | 453.85 g/mol |
| Exact Mass | 453.23 |
| IUPAC Name | N-tert-butyl-11-[ethyl(dimethyl)silyl]-11-methyl-14-trimethylsilyloxy-11-silatetracyclo[7.5.0.02,7.010,12]tetradeca-1(9),2,4,6,10(12),13-hexaen-13-amine |
| SMILES | CC[Si](C)(C)[Si]1(C)c2c3c(c(O[Si](C)(C)C)c(NC(C)(C)C)c21)-c1ccccc1C3 |
| InChI | InChI=1S/C25H39NOSi3/c1-11-29(8,9)30(10)23-19-16-17-14-12-13-15-18(17)20(19)22(27-28(5,6)7)21(24(23)30)26-25(2,3)4/h12-15,26H,11,16H2,1-10H3 |
| InChIKey | XABWBTHDUTWOAZ-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.85 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|