C21H28OSi2 — CID 87936257
(2-cyclopenta-1,3-dien-1-yl-1-methyl-1-propyl-6H-indeno[1,2-b]siliren-3-yl)oxy-trimethylsilane (PubChem CID 87936257) has the molecular formula C21H28OSi2 and a molecular weight of 352.63 g/mol. Its IUPAC name is (2-cyclopenta-1,3-dien-1-yl-1-methyl-1-propyl-6H-indeno[1,2-b]siliren-3-yl)oxy-trimethylsilane.
| Compound Name | (2-cyclopenta-1,3-dien-1-yl-1-methyl-1-propyl-6H-indeno[1,2-b]siliren-3-yl)oxy-trimethylsilane |
|---|---|
| PubChem CID | 87936257 |
| Molecular Formula | C21H28OSi2 |
| Molecular Weight | 352.63 g/mol |
| Exact Mass | 352.17 |
| IUPAC Name | (2-cyclopenta-1,3-dien-1-yl-1-methyl-1-propyl-6H-indeno[1,2-b]siliren-3-yl)oxy-trimethylsilane |
| SMILES | CCC[Si]1(C)C2=C1c1c(ccc(O[Si](C)(C)C)c1C1=CC=CC1)C2 |
| InChI | InChI=1S/C21H28OSi2/c1-6-13-24(5)18-14-16-11-12-17(22-23(2,3)4)19(20(16)21(18)24)15-9-7-8-10-15/h7-9,11-12H,6,10,13-14H2,1-5H3 |
| InChIKey | ABDLGEZSYRASKM-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.63 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|