C26H29N3O5 — CID 87937246
N-[(4R,4aR,7R,7aR,12bS)-3-(cyclopropylmethyl)-9-formamido-11-hydroxy-2,4,4a,5,6,7,7a,13-octahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl]furan-2-carboxamide (PubChem CID 87937246) has the molecular formula C26H29N3O5 and a molecular weight of 463.53 g/mol. Its IUPAC name is N-[(4R,4aR,7R,7aR,12bS)-3-(cyclopropylmethyl)-9-formamido-11-hydroxy-2,4,4a,5,6,7,7a,13-octahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl]furan-2-carboxamide.
| Compound Name | N-[(4R,4aR,7R,7aR,12bS)-3-(cyclopropylmethyl)-9-formamido-11-hydroxy-2,4,4a,5,6,7,7a,13-octahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl]furan-2-carboxamide |
|---|---|
| PubChem CID | 87937246 |
| Molecular Formula | C26H29N3O5 |
| Molecular Weight | 463.53 g/mol |
| Exact Mass | 463.21 |
| IUPAC Name | N-[(4R,4aR,7R,7aR,12bS)-3-(cyclopropylmethyl)-9-formamido-11-hydroxy-2,4,4a,5,6,7,7a,13-octahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl]furan-2-carboxamide |
| SMILES | O=CNc1cc(O)c2c3c1O[C@H]1[C@H](NC(=O)c4ccco4)CC[C@H]4[C@@H](C2)N(CC2CC2)CC[C@@]341 |
| InChI | InChI=1S/C26H29N3O5/c30-13-27-18-11-20(31)15-10-19-16-5-6-17(28-25(32)21-2-1-9-33-21)24-26(16,22(15)23(18)34-24)7-8-29(19)12-14-3-4-14/h1-2,9,11,13-14,16-17,19,24,31H,3-8,10,12H2,(H,27,30)(H,28,32)/t16-,17+,19+,24-,26-/m0/s1 |
| InChIKey | ZUKBOVHPMBDTEY-TZWKQQFLSA-N |
| XLogP | 2.80 |
| TPSA | 104.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.53 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|