C21H15FN4OS — CID 87937419
3-[8-(4-fluorophenyl)-2-oxo-1,3-dihydro-1,5-benzodiazepin-4-yl]pyridine-2-carbothioamide (PubChem CID 87937419) has the molecular formula C21H15FN4OS and a molecular weight of 390.44 g/mol. Its IUPAC name is 3-[8-(4-fluorophenyl)-2-oxo-1,3-dihydro-1,5-benzodiazepin-4-yl]pyridine-2-carbothioamide.
| Compound Name | 3-[8-(4-fluorophenyl)-2-oxo-1,3-dihydro-1,5-benzodiazepin-4-yl]pyridine-2-carbothioamide |
|---|---|
| PubChem CID | 87937419 |
| Molecular Formula | C21H15FN4OS |
| Molecular Weight | 390.44 g/mol |
| Exact Mass | 390.10 |
| IUPAC Name | 3-[8-(4-fluorophenyl)-2-oxo-1,3-dihydro-1,5-benzodiazepin-4-yl]pyridine-2-carbothioamide |
| SMILES | NC(=S)c1ncccc1C1=Nc2ccc(-c3ccc(F)cc3)cc2NC(=O)C1 |
| InChI | InChI=1S/C21H15FN4OS/c22-14-6-3-12(4-7-14)13-5-8-16-18(10-13)26-19(27)11-17(25-16)15-2-1-9-24-20(15)21(23)28/h1-10H,11H2,(H2,23,28)(H,26,27) |
| InChIKey | OLQWLJJSEZKMNO-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 80.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.44 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|