C14H14F3NO3 — CID 87937607
ethyl 3-formyl-2-methyl-6-(trifluoromethyl)-2,3-dihydroindole-1-carboxylate (PubChem CID 87937607) has the molecular formula C14H14F3NO3 and a molecular weight of 301.26 g/mol. Its IUPAC name is ethyl 3-formyl-2-methyl-6-(trifluoromethyl)-2,3-dihydroindole-1-carboxylate.
| Compound Name | ethyl 3-formyl-2-methyl-6-(trifluoromethyl)-2,3-dihydroindole-1-carboxylate |
|---|---|
| PubChem CID | 87937607 |
| Molecular Formula | C14H14F3NO3 |
| Molecular Weight | 301.26 g/mol |
| Exact Mass | 301.09 |
| IUPAC Name | ethyl 3-formyl-2-methyl-6-(trifluoromethyl)-2,3-dihydroindole-1-carboxylate |
| SMILES | CCOC(=O)N1c2cc(C(F)(F)F)ccc2C(C=O)C1C |
| InChI | InChI=1S/C14H14F3NO3/c1-3-21-13(20)18-8(2)11(7-19)10-5-4-9(6-12(10)18)14(15,16)17/h4-8,11H,3H2,1-2H3 |
| InChIKey | SPDYJCNUNGBUNB-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.26 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|