C16H24F3NO5 — CID 87940767
3-O-tert-butyl 1-O-ethyl 2-[1-(2,2,2-trifluoroacetyl)piperidin-4-yl]propanedioate (PubChem CID 87940767) has the molecular formula C16H24F3NO5 and a molecular weight of 367.36 g/mol. Its IUPAC name is 3-O-tert-butyl 1-O-ethyl 2-[1-(2,2,2-trifluoroacetyl)piperidin-4-yl]propanedioate.
| Compound Name | 3-O-tert-butyl 1-O-ethyl 2-[1-(2,2,2-trifluoroacetyl)piperidin-4-yl]propanedioate |
|---|---|
| PubChem CID | 87940767 |
| Molecular Formula | C16H24F3NO5 |
| Molecular Weight | 367.36 g/mol |
| Exact Mass | 367.16 |
| IUPAC Name | 3-O-tert-butyl 1-O-ethyl 2-[1-(2,2,2-trifluoroacetyl)piperidin-4-yl]propanedioate |
| SMILES | CCOC(=O)C(C(=O)OC(C)(C)C)C1CCN(C(=O)C(F)(F)F)CC1 |
| InChI | InChI=1S/C16H24F3NO5/c1-5-24-12(21)11(13(22)25-15(2,3)4)10-6-8-20(9-7-10)14(23)16(17,18)19/h10-11H,5-9H2,1-4H3 |
| InChIKey | UDHNULIIRZOFLY-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.36 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|