C24H19N3O2S — CID 87941308
2-(2-methoxy-5-thiophen-2-ylphenyl)-3-[4-(pyrazin-2-ylamino)phenyl]prop-1-en-1-one (PubChem CID 87941308) has the molecular formula C24H19N3O2S and a molecular weight of 413.50 g/mol. Its IUPAC name is 2-(2-methoxy-5-thiophen-2-ylphenyl)-3-[4-(pyrazin-2-ylamino)phenyl]prop-1-en-1-one.
| Compound Name | 2-(2-methoxy-5-thiophen-2-ylphenyl)-3-[4-(pyrazin-2-ylamino)phenyl]prop-1-en-1-one |
|---|---|
| PubChem CID | 87941308 |
| Molecular Formula | C24H19N3O2S |
| Molecular Weight | 413.50 g/mol |
| Exact Mass | 413.12 |
| IUPAC Name | 2-(2-methoxy-5-thiophen-2-ylphenyl)-3-[4-(pyrazin-2-ylamino)phenyl]prop-1-en-1-one |
| SMILES | COc1ccc(-c2cccs2)cc1C(=C=O)Cc1ccc(Nc2cnccn2)cc1 |
| InChI | InChI=1S/C24H19N3O2S/c1-29-22-9-6-18(23-3-2-12-30-23)14-21(22)19(16-28)13-17-4-7-20(8-5-17)27-24-15-25-10-11-26-24/h2-12,14-15H,13H2,1H3,(H,26,27) |
| InChIKey | ZVRCXMKHLKGSEE-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.50 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ketene', 'substructure': 'N/A'} |
|---|