C18H17N3O4S2 — CID 91630724
2-methoxy-5-[(5-thiophen-2-yl-3-pyridinyl)methylsulfamoyl]benzamide (PubChem CID 91630724) has the molecular formula C18H17N3O4S2 and a molecular weight of 403.49 g/mol. Its IUPAC name is 2-methoxy-5-[(5-thiophen-2-yl-3-pyridinyl)methylsulfamoyl]benzamide.
| Compound Name | 2-methoxy-5-[(5-thiophen-2-yl-3-pyridinyl)methylsulfamoyl]benzamide |
|---|---|
| PubChem CID | 91630724 |
| Molecular Formula | C18H17N3O4S2 |
| Molecular Weight | 403.49 g/mol |
| Exact Mass | 403.07 |
| IUPAC Name | 2-methoxy-5-[(5-thiophen-2-yl-3-pyridinyl)methylsulfamoyl]benzamide |
| SMILES | COc1ccc(S(=O)(=O)NCc2cncc(-c3cccs3)c2)cc1C(N)=O |
| InChI | InChI=1S/C18H17N3O4S2/c1-25-16-5-4-14(8-15(16)18(19)22)27(23,24)21-10-12-7-13(11-20-9-12)17-3-2-6-26-17/h2-9,11,21H,10H2,1H3,(H2,19,22) |
| InChIKey | AUGMCTSYYDEWDI-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 111.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.49 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |