C17H16N2O5S2 — CID 122264461
2-methoxy-5-[(5-thiophen-2-ylfuran-2-yl)methylsulfamoyl]benzamide (PubChem CID 122264461) has the molecular formula C17H16N2O5S2 and a molecular weight of 392.46 g/mol. Its IUPAC name is 2-methoxy-5-[(5-thiophen-2-ylfuran-2-yl)methylsulfamoyl]benzamide.
| Compound Name | 2-methoxy-5-[(5-thiophen-2-ylfuran-2-yl)methylsulfamoyl]benzamide |
|---|---|
| PubChem CID | 122264461 |
| Molecular Formula | C17H16N2O5S2 |
| Molecular Weight | 392.46 g/mol |
| Exact Mass | 392.05 |
| IUPAC Name | 2-methoxy-5-[(5-thiophen-2-ylfuran-2-yl)methylsulfamoyl]benzamide |
| SMILES | COc1ccc(S(=O)(=O)NCc2ccc(-c3cccs3)o2)cc1C(N)=O |
| InChI | InChI=1S/C17H16N2O5S2/c1-23-14-7-5-12(9-13(14)17(18)20)26(21,22)19-10-11-4-6-15(24-11)16-3-2-8-25-16/h2-9,19H,10H2,1H3,(H2,18,20) |
| InChIKey | IASWCFIXVUWONI-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 111.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.46 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |