C16H12F3NO4S2 — CID 122264443
N-[(5-thiophen-2-ylfuran-2-yl)methyl]-4-(trifluoromethoxy)benzenesulfonamide (PubChem CID 122264443) has the molecular formula C16H12F3NO4S2 and a molecular weight of 403.40 g/mol. Its IUPAC name is N-[(5-thiophen-2-ylfuran-2-yl)methyl]-4-(trifluoromethoxy)benzenesulfonamide.
| Compound Name | N-[(5-thiophen-2-ylfuran-2-yl)methyl]-4-(trifluoromethoxy)benzenesulfonamide |
|---|---|
| PubChem CID | 122264443 |
| Molecular Formula | C16H12F3NO4S2 |
| Molecular Weight | 403.40 g/mol |
| Exact Mass | 403.02 |
| IUPAC Name | N-[(5-thiophen-2-ylfuran-2-yl)methyl]-4-(trifluoromethoxy)benzenesulfonamide |
| SMILES | O=S(=O)(NCc1ccc(-c2cccs2)o1)c1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C16H12F3NO4S2/c17-16(18,19)24-11-3-6-13(7-4-11)26(21,22)20-10-12-5-8-14(23-12)15-2-1-9-25-15/h1-9,20H,10H2 |
| InChIKey | FPEJHQLPPDMIHI-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 68.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.40 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |